About 2-[(2-pyridin-1-ium-1-ylacetyl)amino]ethyl propanoate chloride
2-[(2-pyridin-1-ium-1-ylacetyl)amino]ethyl propanoate chloride (PubChem CID 14930) has the molecular formula C12H17ClN2O3
and a molecular weight of 272.73 g/mol. Its IUPAC name is 2-[(2-pyridin-1-ium-1-ylacetyl)amino]ethyl propanoate chloride.
Molecular Properties
| Compound Name | 2-[(2-pyridin-1-ium-1-ylacetyl)amino]ethyl propanoate chloride |
| PubChem CID | 14930 |
| Molecular Formula | C12H17ClN2O3 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-[(2-pyridin-1-ium-1-ylacetyl)amino]ethyl propanoate chloride |
| SMILES | CCC(=O)OCCNC(=O)C[n+]1ccccc1.[Cl-] |
| InChI | InChI=1S/C12H16N2O3.ClH/c1-2-12(16)17-9-6-13-11(15)10-14-7-4-3-5-8-14;/h3-5,7-8H,2,6,9-10H2,1H3;1H |
| InChIKey | OSCJJMKLQGAGML-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-pyridin-1-ium-1-ylacetyl)amino]ethyl propanoate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-pyridin-1-ium-1-ylacetyl)amino]ethyl propanoate chloride?
The IUPAC name of 2-[(2-pyridin-1-ium-1-ylacetyl)amino]ethyl propanoate chloride (CID 14930) is 2-[(2-pyridin-1-ium-1-ylacetyl)amino]ethyl propanoate chloride.
What is the SMILES notation for 2-[(2-pyridin-1-ium-1-ylacetyl)amino]ethyl propanoate chloride?
The canonical SMILES for 2-[(2-pyridin-1-ium-1-ylacetyl)amino]ethyl propanoate chloride is CCC(=O)OCCNC(=O)C[n+]1ccccc1.[Cl-].
What is the InChIKey of 2-[(2-pyridin-1-ium-1-ylacetyl)amino]ethyl propanoate chloride?
The InChIKey is OSCJJMKLQGAGML-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3.ClH/c1-2-12(16)17-9-6-13-11(15)10-14-7-4-3-5-8-14;/h3-5,7-8H,2,6,9-10H2,1H3;1H.
What are the key properties of 2-[(2-pyridin-1-ium-1-ylacetyl)amino]ethyl propanoate chloride?
2-[(2-pyridin-1-ium-1-ylacetyl)amino]ethyl propanoate chloride has a molecular weight of 272.73 g/mol, XLogP of -2.95, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-pyridin-1-ium-1-ylacetyl)amino]ethyl propanoate chloride is sourced from PubChem (CID 14930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).