C24H31ClN5O8PS — CID 149301507
[1-[[(2S,3S,4R,5R)-5-[6-chloro-4-[(2-methylcyclopentyl)amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]-2-phenylethyl]phosphonic acid (PubChem CID 149301507) has the molecular formula C24H31ClN5O8PS and a molecular weight of 616.03 g/mol. Its IUPAC name is [1-[[(2S,3S,4R,5R)-5-[6-chloro-4-[(2-methylcyclopentyl)amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]-2-phenylethyl]phosphonic acid.
| Compound Name | [1-[[(2S,3S,4R,5R)-5-[6-chloro-4-[(2-methylcyclopentyl)amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]-2-phenylethyl]phosphonic acid |
|---|---|
| PubChem CID | 149301507 |
| Molecular Formula | C24H31ClN5O8PS |
| Molecular Weight | 616.03 g/mol |
| Exact Mass | 615.13 |
| IUPAC Name | [1-[[(2S,3S,4R,5R)-5-[6-chloro-4-[(2-methylcyclopentyl)amino]pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]-2-phenylethyl]phosphonic acid |
| SMILES | CC1CCCC1Nc1nc(Cl)nc2c1cnn2[C@@H]1O[C@H](CS(=O)(=O)C(Cc2ccccc2)P(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C24H31ClN5O8PS/c1-13-6-5-9-16(13)27-21-15-11-26-30(22(15)29-24(25)28-21)23-20(32)19(31)17(38-23)12-40(36,37)18(39(33,34)35)10-14-7-3-2-4-8-14/h2-4,7-8,11,13,16-20,23,31-32H,5-6,9-10,12H2,1H3,(H,27,28,29)(H2,33,34,35)/t13?,16?,17-,18?,19-,20-,23-/m1/s1 |
| InChIKey | XWVPPUJSNNNSRX-HXCJRWSISA-N |
| XLogP | 1.86 |
| TPSA | 196.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.03 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|