About 3-amino-N-ethanimidoyl-5,6-dimethylpyrazine-2-carboxamide
3-amino-N-ethanimidoyl-5,6-dimethylpyrazine-2-carboxamide (PubChem CID 149304952) has the molecular formula C9H13N5O
and a molecular weight of 207.24 g/mol. Its IUPAC name is 3-amino-N-ethanimidoyl-5,6-dimethylpyrazine-2-carboxamide.
Molecular Properties
| Compound Name | 3-amino-N-ethanimidoyl-5,6-dimethylpyrazine-2-carboxamide |
| PubChem CID | 149304952 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 3-amino-N-ethanimidoyl-5,6-dimethylpyrazine-2-carboxamide |
| SMILES | [H]/N=C(\C)NC(=O)c1nc(C)c(C)nc1N |
| InChI | InChI=1S/C9H13N5O/c1-4-5(2)13-8(11)7(12-4)9(15)14-6(3)10/h1-3H3,(H2,11,13)(H2,10,14,15) |
| InChIKey | XXMFIASXOLNIHJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N-ethanimidoyl-5,6-dimethylpyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-ethanimidoyl-5,6-dimethylpyrazine-2-carboxamide?
The IUPAC name of 3-amino-N-ethanimidoyl-5,6-dimethylpyrazine-2-carboxamide (CID 149304952) is 3-amino-N-ethanimidoyl-5,6-dimethylpyrazine-2-carboxamide.
What is the SMILES notation for 3-amino-N-ethanimidoyl-5,6-dimethylpyrazine-2-carboxamide?
The canonical SMILES for 3-amino-N-ethanimidoyl-5,6-dimethylpyrazine-2-carboxamide is [H]/N=C(\C)NC(=O)c1nc(C)c(C)nc1N.
What is the InChIKey of 3-amino-N-ethanimidoyl-5,6-dimethylpyrazine-2-carboxamide?
The InChIKey is XXMFIASXOLNIHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5O/c1-4-5(2)13-8(11)7(12-4)9(15)14-6(3)10/h1-3H3,(H2,11,13)(H2,10,14,15).
What are the key properties of 3-amino-N-ethanimidoyl-5,6-dimethylpyrazine-2-carboxamide?
3-amino-N-ethanimidoyl-5,6-dimethylpyrazine-2-carboxamide has a molecular weight of 207.24 g/mol, XLogP of 0.40, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-ethanimidoyl-5,6-dimethylpyrazine-2-carboxamide is sourced from PubChem (CID 149304952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).