C17H21BFNO4S — CID 149306570
1-cyclopropylsulfonyl-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 149306570) has the molecular formula C17H21BFNO4S and a molecular weight of 365.24 g/mol. Its IUPAC name is 1-cyclopropylsulfonyl-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 1-cyclopropylsulfonyl-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 149306570 |
| Molecular Formula | C17H21BFNO4S |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 1-cyclopropylsulfonyl-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | CC1(C)OB(c2cc(F)cc3c2ccn3S(=O)(=O)C2CC2)OC1(C)C |
| InChI | InChI=1S/C17H21BFNO4S/c1-16(2)17(3,4)24-18(23-16)14-9-11(19)10-15-13(14)7-8-20(15)25(21,22)12-5-6-12/h7-10,12H,5-6H2,1-4H3 |
| InChIKey | XXUBVKVWLBBLPC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|