C20H22N6O4S — CID 149307446
6-[(3R)-3-methylmorpholin-4-yl]-1-methylsulfonyl-4-(1H-pyrrolo[2,3-d]pyridazin-4-yl)-8-oxa-3,5-diazatricyclo[7.1.1.02,7]undeca-2(7),3,5-triene (PubChem CID 149307446) has the molecular formula C20H22N6O4S and a molecular weight of 442.50 g/mol. Its IUPAC name is 6-[(3R)-3-methylmorpholin-4-yl]-1-methylsulfonyl-4-(1H-pyrrolo[2,3-d]pyridazin-4-yl)-8-oxa-3,5-diazatricyclo[7.1.1.02,7]undeca-2(7),3,5-triene.
| Compound Name | 6-[(3R)-3-methylmorpholin-4-yl]-1-methylsulfonyl-4-(1H-pyrrolo[2,3-d]pyridazin-4-yl)-8-oxa-3,5-diazatricyclo[7.1.1.02,7]undeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 149307446 |
| Molecular Formula | C20H22N6O4S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 6-[(3R)-3-methylmorpholin-4-yl]-1-methylsulfonyl-4-(1H-pyrrolo[2,3-d]pyridazin-4-yl)-8-oxa-3,5-diazatricyclo[7.1.1.02,7]undeca-2(7),3,5-triene |
| SMILES | C[C@@H]1COCCN1c1nc(-c2nncc3[nH]ccc23)nc2c1OC1CC2(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C20H22N6O4S/c1-11-10-29-6-5-26(11)19-16-17(20(31(2,27)28)7-12(8-20)30-16)23-18(24-19)15-13-3-4-21-14(13)9-22-25-15/h3-4,9,11-12,21H,5-8,10H2,1-2H3/t11-,12?,20?/m1/s1 |
| InChIKey | XXYLURFNVQIEQG-BMTQXLHTSA-N |
| XLogP | 1.43 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |