C23H23F6NO3 — CID 149309350
ethyl (3R,4R)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidine-1-carboxylate (PubChem CID 149309350) has the molecular formula C23H23F6NO3 and a molecular weight of 475.43 g/mol. Its IUPAC name is ethyl (3R,4R)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidine-1-carboxylate.
| Compound Name | ethyl (3R,4R)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 149309350 |
| Molecular Formula | C23H23F6NO3 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | ethyl (3R,4R)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)N1C[C@H](c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)[C@](C)(c2ccccc2)C1 |
| InChI | InChI=1S/C23H23F6NO3/c1-3-33-19(31)30-13-18(20(2,14-30)16-7-5-4-6-8-16)15-9-11-17(12-10-15)21(32,22(24,25)26)23(27,28)29/h4-12,18,32H,3,13-14H2,1-2H3/t18-,20+/m1/s1 |
| InChIKey | XYHMSZPCIZCSPX-QUCCMNQESA-N |
| XLogP | 5.51 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |