C30H25F2N2O+ — CID 149310364
2-(7,9-difluoro-3-methyldibenzofuran-4-yl)-1-methyl-3-(2-propan-2-ylphenyl)benzimidazol-1-ium (PubChem CID 149310364) has the molecular formula C30H25F2N2O+ and a molecular weight of 467.54 g/mol. Its IUPAC name is 2-(7,9-difluoro-3-methyldibenzofuran-4-yl)-1-methyl-3-(2-propan-2-ylphenyl)benzimidazol-1-ium.
| Compound Name | 2-(7,9-difluoro-3-methyldibenzofuran-4-yl)-1-methyl-3-(2-propan-2-ylphenyl)benzimidazol-1-ium |
|---|---|
| PubChem CID | 149310364 |
| Molecular Formula | C30H25F2N2O+ |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 2-(7,9-difluoro-3-methyldibenzofuran-4-yl)-1-methyl-3-(2-propan-2-ylphenyl)benzimidazol-1-ium |
| SMILES | Cc1ccc2c(oc3cc(F)cc(F)c32)c1-c1n(-c2ccccc2C(C)C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C30H25F2N2O/c1-17(2)20-9-5-6-10-23(20)34-25-12-8-7-11-24(25)33(4)30(34)27-18(3)13-14-21-28-22(32)15-19(31)16-26(28)35-29(21)27/h5-17H,1-4H3/q+1 |
| InChIKey | RAMBFXLHRPOAGY-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|