C21H30O4Si — CID 14931255
(4S,4aR,8aS)-2',2'-dimethyl-4-trimethylsilylspiro[1,3,4,4a,8a,9-hexahydrocyclopenta[g]naphthalene-2,5'-1,3-dioxane]-5,8-dione (PubChem CID 14931255) has the molecular formula C21H30O4Si and a molecular weight of 374.55 g/mol. Its IUPAC name is (4S,4aR,8aS)-2',2'-dimethyl-4-trimethylsilylspiro[1,3,4,4a,8a,9-hexahydrocyclopenta[g]naphthalene-2,5'-1,3-dioxane]-5,8-dione.
| Compound Name | (4S,4aR,8aS)-2',2'-dimethyl-4-trimethylsilylspiro[1,3,4,4a,8a,9-hexahydrocyclopenta[g]naphthalene-2,5'-1,3-dioxane]-5,8-dione |
|---|---|
| PubChem CID | 14931255 |
| Molecular Formula | C21H30O4Si |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (4S,4aR,8aS)-2',2'-dimethyl-4-trimethylsilylspiro[1,3,4,4a,8a,9-hexahydrocyclopenta[g]naphthalene-2,5'-1,3-dioxane]-5,8-dione |
| SMILES | CC1(C)OCC2(CO1)CC1=C(C2)[C@@H]([Si](C)(C)C)[C@H]2C(=O)C=CC(=O)[C@H]2C1 |
| InChI | InChI=1S/C21H30O4Si/c1-20(2)24-11-21(12-25-20)9-13-8-14-16(22)6-7-17(23)18(14)19(15(13)10-21)26(3,4)5/h6-7,14,18-19H,8-12H2,1-5H3/t14-,18-,19-/m1/s1 |
| InChIKey | XTJILWAHVIWKOH-NIKGAXFTSA-N |
| XLogP | 3.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|