C29H29ClFN5O3 — CID 149312930
(E)-1-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-ethoxyquinazolin-6-yl]-5-(dimethylamino)-3-fluoropent-3-en-2-one (PubChem CID 149312930) has the molecular formula C29H29ClFN5O3 and a molecular weight of 550.03 g/mol. Its IUPAC name is (E)-1-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-ethoxyquinazolin-6-yl]-5-(dimethylamino)-3-fluoropent-3-en-2-one.
| Compound Name | (E)-1-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-ethoxyquinazolin-6-yl]-5-(dimethylamino)-3-fluoropent-3-en-2-one |
|---|---|
| PubChem CID | 149312930 |
| Molecular Formula | C29H29ClFN5O3 |
| Molecular Weight | 550.03 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | (E)-1-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-7-ethoxyquinazolin-6-yl]-5-(dimethylamino)-3-fluoropent-3-en-2-one |
| SMILES | CCOc1cc2ncnc(Nc3ccc(OCc4ccccn4)c(Cl)c3)c2cc1CC(=O)/C(F)=C\CN(C)C |
| InChI | InChI=1S/C29H29ClFN5O3/c1-4-38-28-16-25-22(13-19(28)14-26(37)24(31)10-12-36(2)3)29(34-18-33-25)35-20-8-9-27(23(30)15-20)39-17-21-7-5-6-11-32-21/h5-11,13,15-16,18H,4,12,14,17H2,1-3H3,(H,33,34,35)/b24-10+ |
| InChIKey | XYYQBYQWZZIIHW-YSURURNPSA-N |
| XLogP | 5.93 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.03 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|