C11H19IN2O4 — CID 149314596
2-[2-(2,4-dioxo-1,3-diazinan-1-yl)butoxy]propyl hypoiodite (PubChem CID 149314596) has the molecular formula C11H19IN2O4 and a molecular weight of 370.19 g/mol. Its IUPAC name is 2-[2-(2,4-dioxo-1,3-diazinan-1-yl)butoxy]propyl hypoiodite.
| Compound Name | 2-[2-(2,4-dioxo-1,3-diazinan-1-yl)butoxy]propyl hypoiodite |
|---|---|
| PubChem CID | 149314596 |
| Molecular Formula | C11H19IN2O4 |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 2-[2-(2,4-dioxo-1,3-diazinan-1-yl)butoxy]propyl hypoiodite |
| SMILES | CCC(COC(C)COI)N1CCC(=O)NC1=O |
| InChI | InChI=1S/C11H19IN2O4/c1-3-9(7-17-8(2)6-18-12)14-5-4-10(15)13-11(14)16/h8-9H,3-7H2,1-2H3,(H,13,15,16) |
| InChIKey | XZGKYMPKQSZFEW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|