C15H27F3O2 — CID 149315141
(Z)-3,7-diethyl-9,9,9-trifluoro-4,6-dimethoxynon-4-ene (PubChem CID 149315141) has the molecular formula C15H27F3O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (Z)-3,7-diethyl-9,9,9-trifluoro-4,6-dimethoxynon-4-ene.
| Compound Name | (Z)-3,7-diethyl-9,9,9-trifluoro-4,6-dimethoxynon-4-ene |
|---|---|
| PubChem CID | 149315141 |
| Molecular Formula | C15H27F3O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (Z)-3,7-diethyl-9,9,9-trifluoro-4,6-dimethoxynon-4-ene |
| SMILES | CCC(CC)/C(=C/C(OC)C(CC)CC(F)(F)F)OC |
| InChI | InChI=1S/C15H27F3O2/c1-6-11(7-2)13(19-4)9-14(20-5)12(8-3)10-15(16,17)18/h9,11-12,14H,6-8,10H2,1-5H3/b13-9- |
| InChIKey | XZIXMCYREZQDLG-LCYFTJDESA-N |
| XLogP | 4.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|