About 2-benzylidene-1,3-diazinane
2-benzylidene-1,3-diazinane (PubChem CID 14931630) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 2-benzylidene-1,3-diazinane.
Molecular Properties
| Compound Name | 2-benzylidene-1,3-diazinane |
| PubChem CID | 14931630 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2-benzylidene-1,3-diazinane |
| SMILES | C(=C1NCCCN1)c1ccccc1 |
| InChI | InChI=1S/C11H14N2/c1-2-5-10(6-3-1)9-11-12-7-4-8-13-11/h1-3,5-6,9,12-13H,4,7-8H2 |
| InChIKey | DKBJYFVSFDDKDL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzylidene-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylidene-1,3-diazinane?
The IUPAC name of 2-benzylidene-1,3-diazinane (CID 14931630) is 2-benzylidene-1,3-diazinane.
What is the SMILES notation for 2-benzylidene-1,3-diazinane?
The canonical SMILES for 2-benzylidene-1,3-diazinane is C(=C1NCCCN1)c1ccccc1.
What is the InChIKey of 2-benzylidene-1,3-diazinane?
The InChIKey is DKBJYFVSFDDKDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c1-2-5-10(6-3-1)9-11-12-7-4-8-13-11/h1-3,5-6,9,12-13H,4,7-8H2.
What are the key properties of 2-benzylidene-1,3-diazinane?
2-benzylidene-1,3-diazinane has a molecular weight of 174.25 g/mol, XLogP of 1.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylidene-1,3-diazinane is sourced from PubChem (CID 14931630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).