C23H25N2O2S+ — CID 149319928
N-cyclopropyl-4-methyl-3-(2-oxospiro[1H-indole-3,4'-thian-1-ium]-6-yl)benzamide (PubChem CID 149319928) has the molecular formula C23H25N2O2S+ and a molecular weight of 393.53 g/mol. Its IUPAC name is N-cyclopropyl-4-methyl-3-(2-oxospiro[1H-indole-3,4'-thian-1-ium]-6-yl)benzamide.
| Compound Name | N-cyclopropyl-4-methyl-3-(2-oxospiro[1H-indole-3,4'-thian-1-ium]-6-yl)benzamide |
|---|---|
| PubChem CID | 149319928 |
| Molecular Formula | C23H25N2O2S+ |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | N-cyclopropyl-4-methyl-3-(2-oxospiro[1H-indole-3,4'-thian-1-ium]-6-yl)benzamide |
| SMILES | Cc1ccc(C(=O)NC2CC2)cc1-c1ccc2c(c1)NC(=O)C21CC[SH+]CC1 |
| InChI | InChI=1S/C23H24N2O2S/c1-14-2-3-16(21(26)24-17-5-6-17)12-18(14)15-4-7-19-20(13-15)25-22(27)23(19)8-10-28-11-9-23/h2-4,7,12-13,17H,5-6,8-11H2,1H3,(H,24,26)(H,25,27)/p+1 |
| InChIKey | YAGLTDOTGUWDOZ-UHFFFAOYSA-O |
| XLogP | 3.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|