C9H14O3 — CID 149320064
(3S)-spiro[2,3,3a,4,6,7a-hexahydrofuro[3,2-c]pyran-7,1'-cyclopropane]-3-ol (PubChem CID 149320064) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is (3S)-spiro[2,3,3a,4,6,7a-hexahydrofuro[3,2-c]pyran-7,1'-cyclopropane]-3-ol.
| Compound Name | (3S)-spiro[2,3,3a,4,6,7a-hexahydrofuro[3,2-c]pyran-7,1'-cyclopropane]-3-ol |
|---|---|
| PubChem CID | 149320064 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (3S)-spiro[2,3,3a,4,6,7a-hexahydrofuro[3,2-c]pyran-7,1'-cyclopropane]-3-ol |
| SMILES | O[C@@H]1COC2C1COCC21CC1 |
| InChI | InChI=1S/C9H14O3/c10-7-4-12-8-6(7)3-11-5-9(8)1-2-9/h6-8,10H,1-5H2/t6?,7-,8?/m1/s1 |
| InChIKey | YAHDCFKUPXTENN-ZUEIMRROSA-N |
| XLogP | 0.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |