About (3S)-7-bromo-5-(4-chlorophenyl)-1-ethanimidoyl-3-methyl-3H-1,4-benzodiazepin-2-imine
(3S)-7-bromo-5-(4-chlorophenyl)-1-ethanimidoyl-3-methyl-3H-1,4-benzodiazepin-2-imine (PubChem CID 149323015) has the molecular formula C18H16BrClN4
and a molecular weight of 403.71 g/mol. Its IUPAC name is (3S)-7-bromo-5-(4-chlorophenyl)-1-ethanimidoyl-3-methyl-3H-1,4-benzodiazepin-2-imine.
Molecular Properties
| Compound Name | (3S)-7-bromo-5-(4-chlorophenyl)-1-ethanimidoyl-3-methyl-3H-1,4-benzodiazepin-2-imine |
| PubChem CID | 149323015 |
| Molecular Formula | C18H16BrClN4 |
| Molecular Weight | 403.71 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | (3S)-7-bromo-5-(4-chlorophenyl)-1-ethanimidoyl-3-methyl-3H-1,4-benzodiazepin-2-imine |
| SMILES | [H]/N=C(\C)N1/C(=N/[H])[C@H](C)N=C(c2ccc(Cl)cc2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C18H16BrClN4/c1-10-18(22)24(11(2)21)16-8-5-13(19)9-15(16)17(23-10)12-3-6-14(20)7-4-12/h3-10,21-22H,1-2H3/b21-11+,22-18+/t10-/m0/s1 |
| InChIKey | YAVJCNAHZJDASV-GHXWGMHLSA-N |
| XLogP | 5.12 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.71 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (3S)-7-bromo-5-(4-chlorophenyl)-1-ethanimidoyl-3-methyl-3H-1,4-benzodiazepin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-7-bromo-5-(4-chlorophenyl)-1-ethanimidoyl-3-methyl-3H-1,4-benzodiazepin-2-imine?
The IUPAC name of (3S)-7-bromo-5-(4-chlorophenyl)-1-ethanimidoyl-3-methyl-3H-1,4-benzodiazepin-2-imine (CID 149323015) is (3S)-7-bromo-5-(4-chlorophenyl)-1-ethanimidoyl-3-methyl-3H-1,4-benzodiazepin-2-imine.
What is the SMILES notation for (3S)-7-bromo-5-(4-chlorophenyl)-1-ethanimidoyl-3-methyl-3H-1,4-benzodiazepin-2-imine?
The canonical SMILES for (3S)-7-bromo-5-(4-chlorophenyl)-1-ethanimidoyl-3-methyl-3H-1,4-benzodiazepin-2-imine is [H]/N=C(\C)N1/C(=N/[H])[C@H](C)N=C(c2ccc(Cl)cc2)c2cc(Br)ccc21.
What is the InChIKey of (3S)-7-bromo-5-(4-chlorophenyl)-1-ethanimidoyl-3-methyl-3H-1,4-benzodiazepin-2-imine?
The InChIKey is YAVJCNAHZJDASV-GHXWGMHLSA-N. The full InChI is InChI=1S/C18H16BrClN4/c1-10-18(22)24(11(2)21)16-8-5-13(19)9-15(16)17(23-10)12-3-6-14(20)7-4-12/h3-10,21-22H,1-2H3/b21-11+,22-18+/t10-/m0/s1.
What are the key properties of (3S)-7-bromo-5-(4-chlorophenyl)-1-ethanimidoyl-3-methyl-3H-1,4-benzodiazepin-2-imine?
(3S)-7-bromo-5-(4-chlorophenyl)-1-ethanimidoyl-3-methyl-3H-1,4-benzodiazepin-2-imine has a molecular weight of 403.71 g/mol, XLogP of 5.12, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-7-bromo-5-(4-chlorophenyl)-1-ethanimidoyl-3-methyl-3H-1,4-benzodiazepin-2-imine is sourced from PubChem (CID 149323015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).