About (1,3-dioxoisoindol-2-yl) furan-2-sulfonate
(1,3-dioxoisoindol-2-yl) furan-2-sulfonate (PubChem CID 149323023) has the molecular formula C12H7NO6S
and a molecular weight of 293.26 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) furan-2-sulfonate.
Molecular Properties
| Compound Name | (1,3-dioxoisoindol-2-yl) furan-2-sulfonate |
| PubChem CID | 149323023 |
| Molecular Formula | C12H7NO6S |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) furan-2-sulfonate |
| SMILES | O=C1c2ccccc2C(=O)N1OS(=O)(=O)c1ccco1 |
| InChI | InChI=1S/C12H7NO6S/c14-11-8-4-1-2-5-9(8)12(15)13(11)19-20(16,17)10-6-3-7-18-10/h1-7H |
| InChIKey | YAVKCDKJNXYUBM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (1,3-dioxoisoindol-2-yl) furan-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dioxoisoindol-2-yl) furan-2-sulfonate?
The IUPAC name of (1,3-dioxoisoindol-2-yl) furan-2-sulfonate (CID 149323023) is (1,3-dioxoisoindol-2-yl) furan-2-sulfonate.
What is the SMILES notation for (1,3-dioxoisoindol-2-yl) furan-2-sulfonate?
The canonical SMILES for (1,3-dioxoisoindol-2-yl) furan-2-sulfonate is O=C1c2ccccc2C(=O)N1OS(=O)(=O)c1ccco1.
What is the InChIKey of (1,3-dioxoisoindol-2-yl) furan-2-sulfonate?
The InChIKey is YAVKCDKJNXYUBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7NO6S/c14-11-8-4-1-2-5-9(8)12(15)13(11)19-20(16,17)10-6-3-7-18-10/h1-7H.
What are the key properties of (1,3-dioxoisoindol-2-yl) furan-2-sulfonate?
(1,3-dioxoisoindol-2-yl) furan-2-sulfonate has a molecular weight of 293.26 g/mol, XLogP of 1.20, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dioxoisoindol-2-yl) furan-2-sulfonate is sourced from PubChem (CID 149323023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).