About thiophene-3,4-dicarbonyl chloride
thiophene-3,4-dicarbonyl chloride (PubChem CID 14932507) has the molecular formula C6H2Cl2O2S
and a molecular weight of 209.05 g/mol. Its IUPAC name is thiophene-3,4-dicarbonyl chloride.
Molecular Properties
| Compound Name | thiophene-3,4-dicarbonyl chloride |
| PubChem CID | 14932507 |
| Molecular Formula | C6H2Cl2O2S |
| Molecular Weight | 209.05 g/mol |
| Exact Mass | 207.92 |
| IUPAC Name | thiophene-3,4-dicarbonyl chloride |
| SMILES | O=C(Cl)c1cscc1C(=O)Cl |
| InChI | InChI=1S/C6H2Cl2O2S/c7-5(9)3-1-11-2-4(3)6(8)10/h1-2H |
| InChIKey | KJEBZMKZUKLTDO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.05 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze thiophene-3,4-dicarbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophene-3,4-dicarbonyl chloride?
The IUPAC name of thiophene-3,4-dicarbonyl chloride (CID 14932507) is thiophene-3,4-dicarbonyl chloride.
What is the SMILES notation for thiophene-3,4-dicarbonyl chloride?
The canonical SMILES for thiophene-3,4-dicarbonyl chloride is O=C(Cl)c1cscc1C(=O)Cl.
What is the InChIKey of thiophene-3,4-dicarbonyl chloride?
The InChIKey is KJEBZMKZUKLTDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Cl2O2S/c7-5(9)3-1-11-2-4(3)6(8)10/h1-2H.
What are the key properties of thiophene-3,4-dicarbonyl chloride?
thiophene-3,4-dicarbonyl chloride has a molecular weight of 209.05 g/mol, XLogP of 2.51, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiophene-3,4-dicarbonyl chloride is sourced from PubChem (CID 14932507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).