About cyclopent-2-en-1-yl methyl carbonate
cyclopent-2-en-1-yl methyl carbonate (PubChem CID 14932676) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is cyclopent-2-en-1-yl methyl carbonate.
Molecular Properties
| Compound Name | cyclopent-2-en-1-yl methyl carbonate |
| PubChem CID | 14932676 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | cyclopent-2-en-1-yl methyl carbonate |
| SMILES | COC(=O)OC1C=CCC1 |
| InChI | InChI=1S/C7H10O3/c1-9-7(8)10-6-4-2-3-5-6/h2,4,6H,3,5H2,1H3 |
| InChIKey | YCYQMWIECYIIKT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclopent-2-en-1-yl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopent-2-en-1-yl methyl carbonate?
The IUPAC name of cyclopent-2-en-1-yl methyl carbonate (CID 14932676) is cyclopent-2-en-1-yl methyl carbonate.
What is the SMILES notation for cyclopent-2-en-1-yl methyl carbonate?
The canonical SMILES for cyclopent-2-en-1-yl methyl carbonate is COC(=O)OC1C=CCC1.
What is the InChIKey of cyclopent-2-en-1-yl methyl carbonate?
The InChIKey is YCYQMWIECYIIKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c1-9-7(8)10-6-4-2-3-5-6/h2,4,6H,3,5H2,1H3.
What are the key properties of cyclopent-2-en-1-yl methyl carbonate?
cyclopent-2-en-1-yl methyl carbonate has a molecular weight of 142.15 g/mol, XLogP of 1.49, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopent-2-en-1-yl methyl carbonate is sourced from PubChem (CID 14932676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).