C9H9N7O4 — CID 149328354
5-[(2-amino-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)diazenyl]-4-hydroxy-2-methyl-1H-pyrimidin-6-one (PubChem CID 149328354) has the molecular formula C9H9N7O4 and a molecular weight of 279.22 g/mol. Its IUPAC name is 5-[(2-amino-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)diazenyl]-4-hydroxy-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 5-[(2-amino-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)diazenyl]-4-hydroxy-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 149328354 |
| Molecular Formula | C9H9N7O4 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 5-[(2-amino-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)diazenyl]-4-hydroxy-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(O)c(/N=N/c2c(O)nc(N)[nH]c2=O)c(=O)[nH]1 |
| InChI | InChI=1S/C9H9N7O4/c1-2-11-5(17)3(6(18)12-2)15-16-4-7(19)13-9(10)14-8(4)20/h1H3,(H2,11,12,17,18)(H4,10,13,14,19,20)/b16-15+ |
| InChIKey | YBVBXPNXCXWNFT-FOCLMDBBSA-N |
| XLogP | -0.43 |
| TPSA | 182.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|