About 2-(6-methylcyclohex-3-en-1-yl)sulfanylcyclohexa-1,5-diene-1-sulfinate
2-(6-methylcyclohex-3-en-1-yl)sulfanylcyclohexa-1,5-diene-1-sulfinate (PubChem CID 149328429) has the molecular formula C13H17O2S2-
and a molecular weight of 269.41 g/mol. Its IUPAC name is 2-(6-methylcyclohex-3-en-1-yl)sulfanylcyclohexa-1,5-diene-1-sulfinate.
Molecular Properties
| Compound Name | 2-(6-methylcyclohex-3-en-1-yl)sulfanylcyclohexa-1,5-diene-1-sulfinate |
| PubChem CID | 149328429 |
| Molecular Formula | C13H17O2S2- |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-(6-methylcyclohex-3-en-1-yl)sulfanylcyclohexa-1,5-diene-1-sulfinate |
| SMILES | CC1CC=CCC1SC1=C(S(=O)[O-])C=CCC1 |
| InChI | InChI=1S/C13H18O2S2/c1-10-6-2-3-7-11(10)16-12-8-4-5-9-13(12)17(14)15/h2-3,5,9-11H,4,6-8H2,1H3,(H,14,15)/p-1 |
| InChIKey | VGNONQHKQGIPPJ-UHFFFAOYSA-M |
| XLogP | 3.52 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-methylcyclohex-3-en-1-yl)sulfanylcyclohexa-1,5-diene-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methylcyclohex-3-en-1-yl)sulfanylcyclohexa-1,5-diene-1-sulfinate?
The IUPAC name of 2-(6-methylcyclohex-3-en-1-yl)sulfanylcyclohexa-1,5-diene-1-sulfinate (CID 149328429) is 2-(6-methylcyclohex-3-en-1-yl)sulfanylcyclohexa-1,5-diene-1-sulfinate.
What is the SMILES notation for 2-(6-methylcyclohex-3-en-1-yl)sulfanylcyclohexa-1,5-diene-1-sulfinate?
The canonical SMILES for 2-(6-methylcyclohex-3-en-1-yl)sulfanylcyclohexa-1,5-diene-1-sulfinate is CC1CC=CCC1SC1=C(S(=O)[O-])C=CCC1.
What is the InChIKey of 2-(6-methylcyclohex-3-en-1-yl)sulfanylcyclohexa-1,5-diene-1-sulfinate?
The InChIKey is VGNONQHKQGIPPJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H18O2S2/c1-10-6-2-3-7-11(10)16-12-8-4-5-9-13(12)17(14)15/h2-3,5,9-11H,4,6-8H2,1H3,(H,14,15)/p-1.
What are the key properties of 2-(6-methylcyclohex-3-en-1-yl)sulfanylcyclohexa-1,5-diene-1-sulfinate?
2-(6-methylcyclohex-3-en-1-yl)sulfanylcyclohexa-1,5-diene-1-sulfinate has a molecular weight of 269.41 g/mol, XLogP of 3.52, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methylcyclohex-3-en-1-yl)sulfanylcyclohexa-1,5-diene-1-sulfinate is sourced from PubChem (CID 149328429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).