C33H32FN7O2 — CID 149329341
4-[[4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]-5-(2-fluoro-4-pyridinyl)pyrimidin-2-yl]amino]piperidin-1-yl]methyl]benzamide (PubChem CID 149329341) has the molecular formula C33H32FN7O2 and a molecular weight of 577.66 g/mol. Its IUPAC name is 4-[[4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]-5-(2-fluoro-4-pyridinyl)pyrimidin-2-yl]amino]piperidin-1-yl]methyl]benzamide.
| Compound Name | 4-[[4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]-5-(2-fluoro-4-pyridinyl)pyrimidin-2-yl]amino]piperidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 149329341 |
| Molecular Formula | C33H32FN7O2 |
| Molecular Weight | 577.66 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | 4-[[4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]-5-(2-fluoro-4-pyridinyl)pyrimidin-2-yl]amino]piperidin-1-yl]methyl]benzamide |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1Oc1nc(NC2CCN(Cc3ccc(C(N)=O)cc3)CC2)ncc1-c1ccnc(F)c1 |
| InChI | InChI=1S/C33H32FN7O2/c1-21-16-24(4-3-12-35)17-22(2)30(21)43-32-28(26-9-13-37-29(34)18-26)19-38-33(40-32)39-27-10-14-41(15-11-27)20-23-5-7-25(8-6-23)31(36)42/h3-9,13,16-19,27H,10-11,14-15,20H2,1-2H3,(H2,36,42)(H,38,39,40)/b4-3+ |
| InChIKey | YBZVUYZGYISMEE-ONEGZZNKSA-N |
| XLogP | 5.80 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.66 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|