C15H19NO6S — CID 14933002
dimethyl 1-(4-methylphenyl)sulfonylpyrrolidine-3,3-dicarboxylate (PubChem CID 14933002) has the molecular formula C15H19NO6S and a molecular weight of 341.39 g/mol. Its IUPAC name is dimethyl 1-(4-methylphenyl)sulfonylpyrrolidine-3,3-dicarboxylate.
| Compound Name | dimethyl 1-(4-methylphenyl)sulfonylpyrrolidine-3,3-dicarboxylate |
|---|---|
| PubChem CID | 14933002 |
| Molecular Formula | C15H19NO6S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | dimethyl 1-(4-methylphenyl)sulfonylpyrrolidine-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CCN(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C15H19NO6S/c1-11-4-6-12(7-5-11)23(19,20)16-9-8-15(10-16,13(17)21-2)14(18)22-3/h4-7H,8-10H2,1-3H3 |
| InChIKey | GDUDOUSMCCHFHH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|