C18H28BFN2O3 — CID 149330691
4-fluoro-N-(2-morpholin-4-ylethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 149330691) has the molecular formula C18H28BFN2O3 and a molecular weight of 350.24 g/mol. Its IUPAC name is 4-fluoro-N-(2-morpholin-4-ylethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | 4-fluoro-N-(2-morpholin-4-ylethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 149330691 |
| Molecular Formula | C18H28BFN2O3 |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 4-fluoro-N-(2-morpholin-4-ylethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CC1(C)OB(c2cc(NCCN3CCOCC3)ccc2F)OC1(C)C |
| InChI | InChI=1S/C18H28BFN2O3/c1-17(2)18(3,4)25-19(24-17)15-13-14(5-6-16(15)20)21-7-8-22-9-11-23-12-10-22/h5-6,13,21H,7-12H2,1-4H3 |
| InChIKey | YCGBUOMWMNLKGQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|