C15H20N4O — CID 149332703
8-methoxy-N,7-dimethyl-N-[(3R)-pyrrolidin-3-yl]quinazolin-4-amine (PubChem CID 149332703) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 8-methoxy-N,7-dimethyl-N-[(3R)-pyrrolidin-3-yl]quinazolin-4-amine.
| Compound Name | 8-methoxy-N,7-dimethyl-N-[(3R)-pyrrolidin-3-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 149332703 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 8-methoxy-N,7-dimethyl-N-[(3R)-pyrrolidin-3-yl]quinazolin-4-amine |
| SMILES | COc1c(C)ccc2c(N(C)[C@@H]3CCNC3)ncnc12 |
| InChI | InChI=1S/C15H20N4O/c1-10-4-5-12-13(14(10)20-3)17-9-18-15(12)19(2)11-6-7-16-8-11/h4-5,9,11,16H,6-8H2,1-3H3/t11-/m1/s1 |
| InChIKey | YCQAFFWGGKYUSF-LLVKDONJSA-N |
| XLogP | 1.74 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |