About CID 149334192
CID 149334192 (PubChem CID 149334192) has the molecular formula C4H8BNOS
and a molecular weight of 128.99 g/mol.
Molecular Properties
| Compound Name | CID 149334192 |
| PubChem CID | 149334192 |
| Molecular Formula | C4H8BNOS |
| Molecular Weight | 128.99 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | — |
| SMILES | [B]CNC(=O)SCC |
| InChI | InChI=1S/C4H8BNOS/c1-2-8-4(7)6-3-5/h2-3H2,1H3,(H,6,7) |
| InChIKey | FBCZXCXUUGFNGM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.99 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze CID 149334192 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 149334192?
The IUPAC name of CID 149334192 (CID 149334192) is not available.
What is the SMILES notation for CID 149334192?
The canonical SMILES for CID 149334192 is [B]CNC(=O)SCC.
What is the InChIKey of CID 149334192?
The InChIKey is FBCZXCXUUGFNGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8BNOS/c1-2-8-4(7)6-3-5/h2-3H2,1H3,(H,6,7).
What are the key properties of CID 149334192?
CID 149334192 has a molecular weight of 128.99 g/mol, XLogP of 0.58, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 149334192 is sourced from PubChem (CID 149334192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).