C16H17N3S — CID 14933594
(2Z)-N,N-dimethyl-2-phenyl-2-(phenylhydrazinylidene)ethanethioamide (PubChem CID 14933594) has the molecular formula C16H17N3S and a molecular weight of 283.40 g/mol. Its IUPAC name is (2Z)-N,N-dimethyl-2-phenyl-2-(phenylhydrazinylidene)ethanethioamide.
| Compound Name | (2Z)-N,N-dimethyl-2-phenyl-2-(phenylhydrazinylidene)ethanethioamide |
|---|---|
| PubChem CID | 14933594 |
| Molecular Formula | C16H17N3S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | (2Z)-N,N-dimethyl-2-phenyl-2-(phenylhydrazinylidene)ethanethioamide |
| SMILES | CN(C)C(=S)/C(=N\Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17N3S/c1-19(2)16(20)15(13-9-5-3-6-10-13)18-17-14-11-7-4-8-12-14/h3-12,17H,1-2H3/b18-15- |
| InChIKey | LNWYRWKUMFNVTC-SDXDJHTJSA-N |
| XLogP | 3.39 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|