C18H19F6N5O3 — CID 149336681
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[imidazo[1,2-b]pyridazine-3-carbonyl(methyl)amino]-4-methylpiperidine-1-carboxylate (PubChem CID 149336681) has the molecular formula C18H19F6N5O3 and a molecular weight of 467.37 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[imidazo[1,2-b]pyridazine-3-carbonyl(methyl)amino]-4-methylpiperidine-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[imidazo[1,2-b]pyridazine-3-carbonyl(methyl)amino]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 149336681 |
| Molecular Formula | C18H19F6N5O3 |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[imidazo[1,2-b]pyridazine-3-carbonyl(methyl)amino]-4-methylpiperidine-1-carboxylate |
| SMILES | CN(C(=O)c1cnc2cccnn12)C1(C)CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H19F6N5O3/c1-16(27(2)13(30)11-10-25-12-4-3-7-26-29(11)12)5-8-28(9-6-16)15(31)32-14(17(19,20)21)18(22,23)24/h3-4,7,10,14H,5-6,8-9H2,1-2H3 |
| InChIKey | YDJLNVRRKVHTFY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |