C24H30IN4O- — CID 149337863
CID 149337863 (PubChem CID 149337863) has the molecular formula C24H30IN4O- and a molecular weight of 517.44 g/mol.
| Compound Name | CID 149337863 |
|---|---|
| PubChem CID | 149337863 |
| Molecular Formula | C24H30IN4O- |
| Molecular Weight | 517.44 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | — |
| SMILES | C=C(c1ccc(N2C(=O)[I-]CC2C)cc1)N1CCN(c2ncc(CC)cc2C)CC1 |
| InChI | InChI=1S/C24H30IN4O/c1-5-20-14-17(2)23(26-16-20)28-12-10-27(11-13-28)19(4)21-6-8-22(9-7-21)29-18(3)15-25-24(29)30/h6-9,14,16,18H,4-5,10-13,15H2,1-3H3/q-1 |
| InChIKey | FRLQLGFUUVPNOY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.44 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|