C11H12N2O — CID 14933813
(2Z)-2-benzylidene-4-methyl-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 14933813) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is (2Z)-2-benzylidene-4-methyl-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z)-2-benzylidene-4-methyl-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 14933813 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | (2Z)-2-benzylidene-4-methyl-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | CC1C/[N+](=C/c2ccccc2)N=C1[O-] |
| InChI | InChI=1S/C11H12N2O/c1-9-7-13(12-11(9)14)8-10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3/b13-8- |
| InChIKey | QXPNMWXZCKYLKS-JYRVWZFOSA-N |
| XLogP | 0.44 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|