C27H20FN2O+ — CID 149339772
2-(7-fluoro-2-methyldibenzofuran-3-yl)-1-methyl-3-phenylbenzimidazol-1-ium (PubChem CID 149339772) has the molecular formula C27H20FN2O+ and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-(7-fluoro-2-methyldibenzofuran-3-yl)-1-methyl-3-phenylbenzimidazol-1-ium.
| Compound Name | 2-(7-fluoro-2-methyldibenzofuran-3-yl)-1-methyl-3-phenylbenzimidazol-1-ium |
|---|---|
| PubChem CID | 149339772 |
| Molecular Formula | C27H20FN2O+ |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 2-(7-fluoro-2-methyldibenzofuran-3-yl)-1-methyl-3-phenylbenzimidazol-1-ium |
| SMILES | Cc1cc2c(cc1-c1n(-c3ccccc3)c3ccccc3[n+]1C)oc1cc(F)ccc12 |
| InChI | InChI=1S/C27H20FN2O/c1-17-14-22-20-13-12-18(28)15-25(20)31-26(22)16-21(17)27-29(2)23-10-6-7-11-24(23)30(27)19-8-4-3-5-9-19/h3-16H,1-2H3/q+1 |
| InChIKey | FSODERVJKQOWAW-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|