C8H8IN5 — CID 149341705
6-(1λ3-iodacyclohexa-2,4,6-trien-3-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 149341705) has the molecular formula C8H8IN5 and a molecular weight of 301.09 g/mol. Its IUPAC name is 6-(1λ3-iodacyclohexa-2,4,6-trien-3-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1λ3-iodacyclohexa-2,4,6-trien-3-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 149341705 |
| Molecular Formula | C8H8IN5 |
| Molecular Weight | 301.09 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | 6-(1λ3-iodacyclohexa-2,4,6-trien-3-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(C2=CI=CC=C2)n1 |
| InChI | InChI=1S/C8H8IN5/c10-7-12-6(13-8(11)14-7)5-2-1-3-9-4-5/h1-4H,(H4,10,11,12,13,14) |
| InChIKey | YEHNXCOVBVCOIT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.09 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|