C22H31BO5 — CID 149343734
methyl 3-[(2R)-6-[(Z)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3,4-dihydro-2H-chromen-2-yl]propanoate (PubChem CID 149343734) has the molecular formula C22H31BO5 and a molecular weight of 386.30 g/mol. Its IUPAC name is methyl 3-[(2R)-6-[(Z)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3,4-dihydro-2H-chromen-2-yl]propanoate.
| Compound Name | methyl 3-[(2R)-6-[(Z)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3,4-dihydro-2H-chromen-2-yl]propanoate |
|---|---|
| PubChem CID | 149343734 |
| Molecular Formula | C22H31BO5 |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | methyl 3-[(2R)-6-[(Z)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3,4-dihydro-2H-chromen-2-yl]propanoate |
| SMILES | COC(=O)CC[C@H]1CCc2cc(/C=C(\C)B3OC(C)(C)C(C)(C)O3)ccc2O1 |
| InChI | InChI=1S/C22H31BO5/c1-15(23-27-21(2,3)22(4,5)28-23)13-16-7-11-19-17(14-16)8-9-18(26-19)10-12-20(24)25-6/h7,11,13-14,18H,8-10,12H2,1-6H3/b15-13+/t18-/m1/s1 |
| InChIKey | YERDEMVMFBFFIJ-FDPSAONLSA-N |
| XLogP | 4.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|