C28H33NO2 — CID 14934527
(1R,2R,4S)-4-(dibenzylamino)-1-hydroxy-2,5-dimethyl-1-phenylhexan-3-one (PubChem CID 14934527) has the molecular formula C28H33NO2 and a molecular weight of 415.58 g/mol. Its IUPAC name is (1R,2R,4S)-4-(dibenzylamino)-1-hydroxy-2,5-dimethyl-1-phenylhexan-3-one.
| Compound Name | (1R,2R,4S)-4-(dibenzylamino)-1-hydroxy-2,5-dimethyl-1-phenylhexan-3-one |
|---|---|
| PubChem CID | 14934527 |
| Molecular Formula | C28H33NO2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | (1R,2R,4S)-4-(dibenzylamino)-1-hydroxy-2,5-dimethyl-1-phenylhexan-3-one |
| SMILES | CC(C)[C@@H](C(=O)[C@H](C)[C@@H](O)c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H33NO2/c1-21(2)26(28(31)22(3)27(30)25-17-11-6-12-18-25)29(19-23-13-7-4-8-14-23)20-24-15-9-5-10-16-24/h4-18,21-22,26-27,30H,19-20H2,1-3H3/t22-,26+,27-/m1/s1 |
| InChIKey | YGMDQZXBORATNW-VYCLJVNGSA-N |
| XLogP | 5.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |