C16H21ClO4 — CID 14934553
dimethyl (3S,3aR,6R,8aR)-6-chloro-3-ethenyl-3,3a,6,7,8,8a-hexahydro-2H-azulene-1,1-dicarboxylate (PubChem CID 14934553) has the molecular formula C16H21ClO4 and a molecular weight of 312.79 g/mol. Its IUPAC name is dimethyl (3S,3aR,6R,8aR)-6-chloro-3-ethenyl-3,3a,6,7,8,8a-hexahydro-2H-azulene-1,1-dicarboxylate.
| Compound Name | dimethyl (3S,3aR,6R,8aR)-6-chloro-3-ethenyl-3,3a,6,7,8,8a-hexahydro-2H-azulene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 14934553 |
| Molecular Formula | C16H21ClO4 |
| Molecular Weight | 312.79 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | dimethyl (3S,3aR,6R,8aR)-6-chloro-3-ethenyl-3,3a,6,7,8,8a-hexahydro-2H-azulene-1,1-dicarboxylate |
| SMILES | C=C[C@@H]1CC(C(=O)OC)(C(=O)OC)[C@@H]2CC[C@@H](Cl)C=C[C@H]12 |
| InChI | InChI=1S/C16H21ClO4/c1-4-10-9-16(14(18)20-2,15(19)21-3)13-8-6-11(17)5-7-12(10)13/h4-5,7,10-13H,1,6,8-9H2,2-3H3/t10-,11+,12-,13-/m1/s1 |
| InChIKey | NWMCFLQCRJBWRR-YVECIDJPSA-N |
| XLogP | 2.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.79 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|