About 4-(2,5-dichlorothiophen-3-yl)-2-(methoxycarbonylamino)-4-oxobutanoic acid
4-(2,5-dichlorothiophen-3-yl)-2-(methoxycarbonylamino)-4-oxobutanoic acid (PubChem CID 14934570) has the molecular formula C10H9Cl2NO5S
and a molecular weight of 326.16 g/mol. Its IUPAC name is 4-(2,5-dichlorothiophen-3-yl)-2-(methoxycarbonylamino)-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-(2,5-dichlorothiophen-3-yl)-2-(methoxycarbonylamino)-4-oxobutanoic acid |
| PubChem CID | 14934570 |
| Molecular Formula | C10H9Cl2NO5S |
| Molecular Weight | 326.16 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | 4-(2,5-dichlorothiophen-3-yl)-2-(methoxycarbonylamino)-4-oxobutanoic acid |
| SMILES | COC(=O)NC(CC(=O)c1cc(Cl)sc1Cl)C(=O)O |
| InChI | InChI=1S/C10H9Cl2NO5S/c1-18-10(17)13-5(9(15)16)3-6(14)4-2-7(11)19-8(4)12/h2,5H,3H2,1H3,(H,13,17)(H,15,16) |
| InChIKey | LBALRTZDFAWRQG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.16 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2,5-dichlorothiophen-3-yl)-2-(methoxycarbonylamino)-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dichlorothiophen-3-yl)-2-(methoxycarbonylamino)-4-oxobutanoic acid?
The IUPAC name of 4-(2,5-dichlorothiophen-3-yl)-2-(methoxycarbonylamino)-4-oxobutanoic acid (CID 14934570) is 4-(2,5-dichlorothiophen-3-yl)-2-(methoxycarbonylamino)-4-oxobutanoic acid.
What is the SMILES notation for 4-(2,5-dichlorothiophen-3-yl)-2-(methoxycarbonylamino)-4-oxobutanoic acid?
The canonical SMILES for 4-(2,5-dichlorothiophen-3-yl)-2-(methoxycarbonylamino)-4-oxobutanoic acid is COC(=O)NC(CC(=O)c1cc(Cl)sc1Cl)C(=O)O.
What is the InChIKey of 4-(2,5-dichlorothiophen-3-yl)-2-(methoxycarbonylamino)-4-oxobutanoic acid?
The InChIKey is LBALRTZDFAWRQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Cl2NO5S/c1-18-10(17)13-5(9(15)16)3-6(14)4-2-7(11)19-8(4)12/h2,5H,3H2,1H3,(H,13,17)(H,15,16).
What are the key properties of 4-(2,5-dichlorothiophen-3-yl)-2-(methoxycarbonylamino)-4-oxobutanoic acid?
4-(2,5-dichlorothiophen-3-yl)-2-(methoxycarbonylamino)-4-oxobutanoic acid has a molecular weight of 326.16 g/mol, XLogP of 2.44, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dichlorothiophen-3-yl)-2-(methoxycarbonylamino)-4-oxobutanoic acid is sourced from PubChem (CID 14934570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).