C7F10 — CID 14934727
1,2,2,3,4,4,5,6,7,7-decafluorotricyclo[3.2.0.03,6]heptane (PubChem CID 14934727) has the molecular formula C7F10 and a molecular weight of 274.06 g/mol. Its IUPAC name is 1,2,2,3,4,4,5,6,7,7-decafluorotricyclo[3.2.0.03,6]heptane.
| Compound Name | 1,2,2,3,4,4,5,6,7,7-decafluorotricyclo[3.2.0.03,6]heptane |
|---|---|
| PubChem CID | 14934727 |
| Molecular Formula | C7F10 |
| Molecular Weight | 274.06 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 1,2,2,3,4,4,5,6,7,7-decafluorotricyclo[3.2.0.03,6]heptane |
| SMILES | FC1(F)C2(F)C(F)(F)C3(F)C1(F)C(F)(F)C23F |
| InChI | InChI=1S/C7F10/c8-1-2(9)4(11,5(1,12)13)7(16,17)3(1,10)6(2,14)15 |
| InChIKey | GQRWKAMAEHQFNN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.06 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |