About (2S,3R)-1,2-dibromopentan-3-ol
(2S,3R)-1,2-dibromopentan-3-ol (PubChem CID 14935814) has the molecular formula C5H10Br2O
and a molecular weight of 245.94 g/mol. Its IUPAC name is (2S,3R)-1,2-dibromopentan-3-ol.
Molecular Properties
| Compound Name | (2S,3R)-1,2-dibromopentan-3-ol |
| PubChem CID | 14935814 |
| Molecular Formula | C5H10Br2O |
| Molecular Weight | 245.94 g/mol |
| Exact Mass | 243.91 |
| IUPAC Name | (2S,3R)-1,2-dibromopentan-3-ol |
| SMILES | CC[C@@H](O)[C@H](Br)CBr |
| InChI | InChI=1S/C5H10Br2O/c1-2-5(8)4(7)3-6/h4-5,8H,2-3H2,1H3/t4-,5-/m1/s1 |
| InChIKey | CXEBEXABJMLJSW-RFZPGFLSSA-N |
| XLogP | 1.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.94 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S,3R)-1,2-dibromopentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-1,2-dibromopentan-3-ol?
The IUPAC name of (2S,3R)-1,2-dibromopentan-3-ol (CID 14935814) is (2S,3R)-1,2-dibromopentan-3-ol.
What is the SMILES notation for (2S,3R)-1,2-dibromopentan-3-ol?
The canonical SMILES for (2S,3R)-1,2-dibromopentan-3-ol is CC[C@@H](O)[C@H](Br)CBr.
What is the InChIKey of (2S,3R)-1,2-dibromopentan-3-ol?
The InChIKey is CXEBEXABJMLJSW-RFZPGFLSSA-N. The full InChI is InChI=1S/C5H10Br2O/c1-2-5(8)4(7)3-6/h4-5,8H,2-3H2,1H3/t4-,5-/m1/s1.
What are the key properties of (2S,3R)-1,2-dibromopentan-3-ol?
(2S,3R)-1,2-dibromopentan-3-ol has a molecular weight of 245.94 g/mol, XLogP of 1.92, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-1,2-dibromopentan-3-ol is sourced from PubChem (CID 14935814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).