About (E)-4-(3,3-difluoroazetidin-1-yl)but-2-enamide
(E)-4-(3,3-difluoroazetidin-1-yl)but-2-enamide (PubChem CID 149361626) has the molecular formula C7H10F2N2O
and a molecular weight of 176.17 g/mol. Its IUPAC name is (E)-4-(3,3-difluoroazetidin-1-yl)but-2-enamide.
Molecular Properties
| Compound Name | (E)-4-(3,3-difluoroazetidin-1-yl)but-2-enamide |
| PubChem CID | 149361626 |
| Molecular Formula | C7H10F2N2O |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (E)-4-(3,3-difluoroazetidin-1-yl)but-2-enamide |
| SMILES | NC(=O)/C=C/CN1CC(F)(F)C1 |
| InChI | InChI=1S/C7H10F2N2O/c8-7(9)4-11(5-7)3-1-2-6(10)12/h1-2H,3-5H2,(H2,10,12)/b2-1+ |
| InChIKey | YIAFAPIBMXFHLA-OWOJBTEDSA-N |
| XLogP | -0.02 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(3,3-difluoroazetidin-1-yl)but-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(3,3-difluoroazetidin-1-yl)but-2-enamide?
The IUPAC name of (E)-4-(3,3-difluoroazetidin-1-yl)but-2-enamide (CID 149361626) is (E)-4-(3,3-difluoroazetidin-1-yl)but-2-enamide.
What is the SMILES notation for (E)-4-(3,3-difluoroazetidin-1-yl)but-2-enamide?
The canonical SMILES for (E)-4-(3,3-difluoroazetidin-1-yl)but-2-enamide is NC(=O)/C=C/CN1CC(F)(F)C1.
What is the InChIKey of (E)-4-(3,3-difluoroazetidin-1-yl)but-2-enamide?
The InChIKey is YIAFAPIBMXFHLA-OWOJBTEDSA-N. The full InChI is InChI=1S/C7H10F2N2O/c8-7(9)4-11(5-7)3-1-2-6(10)12/h1-2H,3-5H2,(H2,10,12)/b2-1+.
What are the key properties of (E)-4-(3,3-difluoroazetidin-1-yl)but-2-enamide?
(E)-4-(3,3-difluoroazetidin-1-yl)but-2-enamide has a molecular weight of 176.17 g/mol, XLogP of -0.02, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(3,3-difluoroazetidin-1-yl)but-2-enamide is sourced from PubChem (CID 149361626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).