About diethyl (1R)-cyclopent-3-ene-1,3-dicarboxylate
diethyl (1R)-cyclopent-3-ene-1,3-dicarboxylate (PubChem CID 14936176) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is diethyl (1R)-cyclopent-3-ene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | diethyl (1R)-cyclopent-3-ene-1,3-dicarboxylate |
| PubChem CID | 14936176 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | diethyl (1R)-cyclopent-3-ene-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1=CC[C@@H](C(=O)OCC)C1 |
| InChI | InChI=1S/C11H16O4/c1-3-14-10(12)8-5-6-9(7-8)11(13)15-4-2/h5,9H,3-4,6-7H2,1-2H3/t9-/m1/s1 |
| InChIKey | WNVXZAQVCGCLKN-SECBINFHSA-N |
| XLogP | 1.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze diethyl (1R)-cyclopent-3-ene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (1R)-cyclopent-3-ene-1,3-dicarboxylate?
The IUPAC name of diethyl (1R)-cyclopent-3-ene-1,3-dicarboxylate (CID 14936176) is diethyl (1R)-cyclopent-3-ene-1,3-dicarboxylate.
What is the SMILES notation for diethyl (1R)-cyclopent-3-ene-1,3-dicarboxylate?
The canonical SMILES for diethyl (1R)-cyclopent-3-ene-1,3-dicarboxylate is CCOC(=O)C1=CC[C@@H](C(=O)OCC)C1.
What is the InChIKey of diethyl (1R)-cyclopent-3-ene-1,3-dicarboxylate?
The InChIKey is WNVXZAQVCGCLKN-SECBINFHSA-N. The full InChI is InChI=1S/C11H16O4/c1-3-14-10(12)8-5-6-9(7-8)11(13)15-4-2/h5,9H,3-4,6-7H2,1-2H3/t9-/m1/s1.
What are the key properties of diethyl (1R)-cyclopent-3-ene-1,3-dicarboxylate?
diethyl (1R)-cyclopent-3-ene-1,3-dicarboxylate has a molecular weight of 212.24 g/mol, XLogP of 1.45, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (1R)-cyclopent-3-ene-1,3-dicarboxylate is sourced from PubChem (CID 14936176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).