C18H32OSi — CID 14936190
triethyl-[(5-methyl-1,2,3,7,8,9-hexahydrobenzo[7]annulen-9a-yl)oxy]silane (PubChem CID 14936190) has the molecular formula C18H32OSi and a molecular weight of 292.54 g/mol. Its IUPAC name is triethyl-[(5-methyl-1,2,3,7,8,9-hexahydrobenzo[7]annulen-9a-yl)oxy]silane.
| Compound Name | triethyl-[(5-methyl-1,2,3,7,8,9-hexahydrobenzo[7]annulen-9a-yl)oxy]silane |
|---|---|
| PubChem CID | 14936190 |
| Molecular Formula | C18H32OSi |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | triethyl-[(5-methyl-1,2,3,7,8,9-hexahydrobenzo[7]annulen-9a-yl)oxy]silane |
| SMILES | CC[Si](CC)(CC)OC12CCCC=C(C)C1=CCCC2 |
| InChI | InChI=1S/C18H32OSi/c1-5-20(6-2,7-3)19-18-14-10-8-12-16(4)17(18)13-9-11-15-18/h12-13H,5-11,14-15H2,1-4H3 |
| InChIKey | JXVLTBPOAFONPY-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|