About triethyl-[(9E)-5-prop-1-ynylundeca-1,9-dien-5-yl]oxysilane
triethyl-[(9E)-5-prop-1-ynylundeca-1,9-dien-5-yl]oxysilane (PubChem CID 14936192) has the molecular formula C20H36OSi
and a molecular weight of 320.59 g/mol. Its IUPAC name is triethyl-[(9E)-5-prop-1-ynylundeca-1,9-dien-5-yl]oxysilane.
Molecular Properties
| Compound Name | triethyl-[(9E)-5-prop-1-ynylundeca-1,9-dien-5-yl]oxysilane |
| PubChem CID | 14936192 |
| Molecular Formula | C20H36OSi |
| Molecular Weight | 320.59 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | triethyl-[(9E)-5-prop-1-ynylundeca-1,9-dien-5-yl]oxysilane |
| SMILES | C=CCCC(C#CC)(CCC/C=C/C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C20H36OSi/c1-7-13-15-16-19-20(17-9-3,18-14-8-2)21-22(10-4,11-5)12-6/h7-8,13H,2,10-12,14-16,18-19H2,1,3-6H3/b13-7+ |
| InChIKey | RNOAARFVTYBXIS-NTUHNPAUSA-N |
| XLogP | 6.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.59 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(9E)-5-prop-1-ynylundeca-1,9-dien-5-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(9E)-5-prop-1-ynylundeca-1,9-dien-5-yl]oxysilane?
The IUPAC name of triethyl-[(9E)-5-prop-1-ynylundeca-1,9-dien-5-yl]oxysilane (CID 14936192) is triethyl-[(9E)-5-prop-1-ynylundeca-1,9-dien-5-yl]oxysilane.
What is the SMILES notation for triethyl-[(9E)-5-prop-1-ynylundeca-1,9-dien-5-yl]oxysilane?
The canonical SMILES for triethyl-[(9E)-5-prop-1-ynylundeca-1,9-dien-5-yl]oxysilane is C=CCCC(C#CC)(CCC/C=C/C)O[Si](CC)(CC)CC.
What is the InChIKey of triethyl-[(9E)-5-prop-1-ynylundeca-1,9-dien-5-yl]oxysilane?
The InChIKey is RNOAARFVTYBXIS-NTUHNPAUSA-N. The full InChI is InChI=1S/C20H36OSi/c1-7-13-15-16-19-20(17-9-3,18-14-8-2)21-22(10-4,11-5)12-6/h7-8,13H,2,10-12,14-16,18-19H2,1,3-6H3/b13-7+.
What are the key properties of triethyl-[(9E)-5-prop-1-ynylundeca-1,9-dien-5-yl]oxysilane?
triethyl-[(9E)-5-prop-1-ynylundeca-1,9-dien-5-yl]oxysilane has a molecular weight of 320.59 g/mol, XLogP of 6.48, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(9E)-5-prop-1-ynylundeca-1,9-dien-5-yl]oxysilane is sourced from PubChem (CID 14936192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).