About 2-chloro-2,3-dihydropyridin-4-amine
2-chloro-2,3-dihydropyridin-4-amine (PubChem CID 149364830) has the molecular formula C5H7ClN2
and a molecular weight of 130.58 g/mol. Its IUPAC name is 2-chloro-2,3-dihydropyridin-4-amine.
Molecular Properties
| Compound Name | 2-chloro-2,3-dihydropyridin-4-amine |
| PubChem CID | 149364830 |
| Molecular Formula | C5H7ClN2 |
| Molecular Weight | 130.58 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | 2-chloro-2,3-dihydropyridin-4-amine |
| SMILES | NC1=CC=NC(Cl)C1 |
| InChI | InChI=1S/C5H7ClN2/c6-5-3-4(7)1-2-8-5/h1-2,5H,3,7H2 |
| InChIKey | YIQILUPLCNKSHT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.58 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-2,3-dihydropyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-2,3-dihydropyridin-4-amine?
The IUPAC name of 2-chloro-2,3-dihydropyridin-4-amine (CID 149364830) is 2-chloro-2,3-dihydropyridin-4-amine.
What is the SMILES notation for 2-chloro-2,3-dihydropyridin-4-amine?
The canonical SMILES for 2-chloro-2,3-dihydropyridin-4-amine is NC1=CC=NC(Cl)C1.
What is the InChIKey of 2-chloro-2,3-dihydropyridin-4-amine?
The InChIKey is YIQILUPLCNKSHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN2/c6-5-3-4(7)1-2-8-5/h1-2,5H,3,7H2.
What are the key properties of 2-chloro-2,3-dihydropyridin-4-amine?
2-chloro-2,3-dihydropyridin-4-amine has a molecular weight of 130.58 g/mol, XLogP of 0.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-2,3-dihydropyridin-4-amine is sourced from PubChem (CID 149364830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).