About butyl 2-pyridin-2-ylacetate
butyl 2-pyridin-2-ylacetate (PubChem CID 14936493) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is butyl 2-pyridin-2-ylacetate.
Molecular Properties
| Compound Name | butyl 2-pyridin-2-ylacetate |
| PubChem CID | 14936493 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | butyl 2-pyridin-2-ylacetate |
| SMILES | CCCCOC(=O)Cc1ccccn1 |
| InChI | InChI=1S/C11H15NO2/c1-2-3-8-14-11(13)9-10-6-4-5-7-12-10/h4-7H,2-3,8-9H2,1H3 |
| InChIKey | AOWFSADDXYTKTN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-pyridin-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-pyridin-2-ylacetate?
The IUPAC name of butyl 2-pyridin-2-ylacetate (CID 14936493) is butyl 2-pyridin-2-ylacetate.
What is the SMILES notation for butyl 2-pyridin-2-ylacetate?
The canonical SMILES for butyl 2-pyridin-2-ylacetate is CCCCOC(=O)Cc1ccccn1.
What is the InChIKey of butyl 2-pyridin-2-ylacetate?
The InChIKey is AOWFSADDXYTKTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-2-3-8-14-11(13)9-10-6-4-5-7-12-10/h4-7H,2-3,8-9H2,1H3.
What are the key properties of butyl 2-pyridin-2-ylacetate?
butyl 2-pyridin-2-ylacetate has a molecular weight of 193.25 g/mol, XLogP of 1.97, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-pyridin-2-ylacetate is sourced from PubChem (CID 14936493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).