C21H20N2O — CID 14936528
3-[(5-methyl-2-pyridinyl)amino]-1,3-diphenylpropan-1-one (PubChem CID 14936528) has the molecular formula C21H20N2O and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-[(5-methyl-2-pyridinyl)amino]-1,3-diphenylpropan-1-one.
| Compound Name | 3-[(5-methyl-2-pyridinyl)amino]-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 14936528 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 3-[(5-methyl-2-pyridinyl)amino]-1,3-diphenylpropan-1-one |
| SMILES | Cc1ccc(NC(CC(=O)c2ccccc2)c2ccccc2)nc1 |
| InChI | InChI=1S/C21H20N2O/c1-16-12-13-21(22-15-16)23-19(17-8-4-2-5-9-17)14-20(24)18-10-6-3-7-11-18/h2-13,15,19H,14H2,1H3,(H,22,23) |
| InChIKey | PDOIPVKUHGPVQP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |