C57H50BNO — CID 149366469
14-[2-(3,5-ditert-butylphenyl)-4-phenylphenyl]-11-methyl-4,18-diphenyl-8-oxa-14-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 149366469) has the molecular formula C57H50BNO and a molecular weight of 775.85 g/mol. Its IUPAC name is 14-[2-(3,5-ditert-butylphenyl)-4-phenylphenyl]-11-methyl-4,18-diphenyl-8-oxa-14-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 14-[2-(3,5-ditert-butylphenyl)-4-phenylphenyl]-11-methyl-4,18-diphenyl-8-oxa-14-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 149366469 |
| Molecular Formula | C57H50BNO |
| Molecular Weight | 775.85 g/mol |
| Exact Mass | 775.40 |
| IUPAC Name | 14-[2-(3,5-ditert-butylphenyl)-4-phenylphenyl]-11-methyl-4,18-diphenyl-8-oxa-14-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | Cc1cc2c3c(c1)N(c1ccc(-c4ccccc4)cc1-c1cc(C(C)(C)C)cc(C(C)(C)C)c1)c1ccc(-c4ccccc4)cc1B3c1cc(-c3ccccc3)ccc1O2 |
| InChI | InChI=1S/C57H50BNO/c1-37-29-52-55-54(30-37)60-53-28-25-43(40-21-15-10-16-22-40)35-49(53)58(55)48-34-42(39-19-13-9-14-20-39)24-27-51(48)59(52)50-26-23-41(38-17-11-8-12-18-38)33-47(50)44-31-45(56(2,3)4)36-46(32-44)57(5,6)7/h8-36H,1-7H3 |
| InChIKey | YIYJDNUCRSITMF-UHFFFAOYSA-N |
| XLogP | 13.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.85 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|