About 2-[(3R,4R)-4-(triphenylstannylmethyl)oxolan-3-yl]acetaldehyde
2-[(3R,4R)-4-(triphenylstannylmethyl)oxolan-3-yl]acetaldehyde (PubChem CID 14936720) has the molecular formula C25H26O2Sn
and a molecular weight of 477.19 g/mol. Its IUPAC name is 2-[(3R,4R)-4-(triphenylstannylmethyl)oxolan-3-yl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[(3R,4R)-4-(triphenylstannylmethyl)oxolan-3-yl]acetaldehyde |
| PubChem CID | 14936720 |
| Molecular Formula | C25H26O2Sn |
| Molecular Weight | 477.19 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 2-[(3R,4R)-4-(triphenylstannylmethyl)oxolan-3-yl]acetaldehyde |
| SMILES | O=CC[C@H]1COC[C@@H]1C[Sn](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C7H11O2.3C6H5.Sn/c1-6-4-9-5-7(6)2-3-8;3*1-2-4-6-5-3-1;/h3,6-7H,1-2,4-5H2;3*1-5H;/t6-,7-;;;;/m0..../s1 |
| InChIKey | AQSKWAIZLFHXKQ-PDFZZBEWSA-N |
| XLogP | 3.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.19 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3R,4R)-4-(triphenylstannylmethyl)oxolan-3-yl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,4R)-4-(triphenylstannylmethyl)oxolan-3-yl]acetaldehyde?
The IUPAC name of 2-[(3R,4R)-4-(triphenylstannylmethyl)oxolan-3-yl]acetaldehyde (CID 14936720) is 2-[(3R,4R)-4-(triphenylstannylmethyl)oxolan-3-yl]acetaldehyde.
What is the SMILES notation for 2-[(3R,4R)-4-(triphenylstannylmethyl)oxolan-3-yl]acetaldehyde?
The canonical SMILES for 2-[(3R,4R)-4-(triphenylstannylmethyl)oxolan-3-yl]acetaldehyde is O=CC[C@H]1COC[C@@H]1C[Sn](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-[(3R,4R)-4-(triphenylstannylmethyl)oxolan-3-yl]acetaldehyde?
The InChIKey is AQSKWAIZLFHXKQ-PDFZZBEWSA-N. The full InChI is InChI=1S/C7H11O2.3C6H5.Sn/c1-6-4-9-5-7(6)2-3-8;3*1-2-4-6-5-3-1;/h3,6-7H,1-2,4-5H2;3*1-5H;/t6-,7-;;;;/m0..../s1.
What are the key properties of 2-[(3R,4R)-4-(triphenylstannylmethyl)oxolan-3-yl]acetaldehyde?
2-[(3R,4R)-4-(triphenylstannylmethyl)oxolan-3-yl]acetaldehyde has a molecular weight of 477.19 g/mol, XLogP of 3.01, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,4R)-4-(triphenylstannylmethyl)oxolan-3-yl]acetaldehyde is sourced from PubChem (CID 14936720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).