About 1-(triisopropylsilyl)-5-(triMethylsilyl)-1,4-dipentayne-3-one
1-(triisopropylsilyl)-5-(triMethylsilyl)-1,4-dipentayne-3-one (PubChem CID 14937074) has the molecular formula C17H30OSi2
and a molecular weight of 306.60 g/mol. Its IUPAC name is 1-trimethylsilyl-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-one.
Molecular Properties
| Compound Name | 1-(triisopropylsilyl)-5-(triMethylsilyl)-1,4-dipentayne-3-one |
| PubChem CID | 14937074 |
| Molecular Formula | C17H30OSi2 |
| Molecular Weight | 306.60 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 1-trimethylsilyl-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-one |
| SMILES | CC(C)[Si](C#CC(=O)C#C[Si](C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H30OSi2/c1-14(2)20(15(3)4,16(5)6)13-11-17(18)10-12-19(7,8)9/h14-16H,1-9H3 |
| InChIKey | CRNHLUMUKFBKHP-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 17.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | 459 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_yne_A(1)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(triisopropylsilyl)-5-(triMethylsilyl)-1,4-dipentayne-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(triisopropylsilyl)-5-(triMethylsilyl)-1,4-dipentayne-3-one?
The IUPAC name of 1-(triisopropylsilyl)-5-(triMethylsilyl)-1,4-dipentayne-3-one (CID 14937074) is 1-trimethylsilyl-5-tri(propan-2-yl)silylpenta-1,4-diyn-3-one.
What is the SMILES notation for 1-(triisopropylsilyl)-5-(triMethylsilyl)-1,4-dipentayne-3-one?
The canonical SMILES for 1-(triisopropylsilyl)-5-(triMethylsilyl)-1,4-dipentayne-3-one is CC(C)[Si](C#CC(=O)C#C[Si](C)(C)C)(C(C)C)C(C)C.
What is the InChIKey of 1-(triisopropylsilyl)-5-(triMethylsilyl)-1,4-dipentayne-3-one?
The InChIKey is CRNHLUMUKFBKHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30OSi2/c1-14(2)20(15(3)4,16(5)6)13-11-17(18)10-12-19(7,8)9/h14-16H,1-9H3.
What are the key properties of 1-(triisopropylsilyl)-5-(triMethylsilyl)-1,4-dipentayne-3-one?
1-(triisopropylsilyl)-5-(triMethylsilyl)-1,4-dipentayne-3-one has a molecular weight of 306.60 g/mol, XLogP of not available, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(triisopropylsilyl)-5-(triMethylsilyl)-1,4-dipentayne-3-one is sourced from PubChem (CID 14937074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).