C44H30I9O8S+ — CID 149374139
bis[4-[2-(2,3,6-triiodobenzoyl)oxyethoxy]phenyl]-[4-[2-(2,3,6-triiodophenoxy)ethoxy]phenyl]sulfanium (PubChem CID 149374139) has the molecular formula C44H30I9O8S+ and a molecular weight of 1860.92 g/mol. Its IUPAC name is bis[4-[2-(2,3,6-triiodobenzoyl)oxyethoxy]phenyl]-[4-[2-(2,3,6-triiodophenoxy)ethoxy]phenyl]sulfanium.
| Compound Name | bis[4-[2-(2,3,6-triiodobenzoyl)oxyethoxy]phenyl]-[4-[2-(2,3,6-triiodophenoxy)ethoxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 149374139 |
| Molecular Formula | C44H30I9O8S+ |
| Molecular Weight | 1860.92 g/mol |
| Exact Mass | 1860.31 |
| IUPAC Name | bis[4-[2-(2,3,6-triiodobenzoyl)oxyethoxy]phenyl]-[4-[2-(2,3,6-triiodophenoxy)ethoxy]phenyl]sulfanium |
| SMILES | O=C(OCCOc1ccc([S+](c2ccc(OCCOC(=O)c3c(I)ccc(I)c3I)cc2)c2ccc(OCCOc3c(I)ccc(I)c3I)cc2)cc1)c1c(I)ccc(I)c1I |
| InChI | InChI=1S/C44H30I9O8S/c45-31-13-15-33(47)39(51)37(31)43(54)60-23-20-57-26-3-9-29(10-4-26)62(28-7-1-25(2-8-28)56-19-22-59-42-36(50)18-17-35(49)41(42)53)30-11-5-27(6-12-30)58-21-24-61-44(55)38-32(46)14-16-34(48)40(38)52/h1-18H,19-24H2/q+1 |
| InChIKey | YKKAWBYEBDFBPC-UHFFFAOYSA-N |
| XLogP | 14.15 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1860.92 |
| LogP ≤ 5 | 14.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|