About 5-[(Z)-3-(1,3-benzodioxol-5-yl)-2-nitroprop-2-enyl]-1,3-benzodioxole
5-[(Z)-3-(1,3-benzodioxol-5-yl)-2-nitroprop-2-enyl]-1,3-benzodioxole (PubChem CID 14938090) has the molecular formula C17H13NO6
and a molecular weight of 327.29 g/mol. Its IUPAC name is 5-[(Z)-3-(1,3-benzodioxol-5-yl)-2-nitroprop-2-enyl]-1,3-benzodioxole.
Molecular Properties
| Compound Name | 5-[(Z)-3-(1,3-benzodioxol-5-yl)-2-nitroprop-2-enyl]-1,3-benzodioxole |
| PubChem CID | 14938090 |
| Molecular Formula | C17H13NO6 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 5-[(Z)-3-(1,3-benzodioxol-5-yl)-2-nitroprop-2-enyl]-1,3-benzodioxole |
| SMILES | O=[N+]([O-])/C(=C\c1ccc2c(c1)OCO2)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H13NO6/c19-18(20)13(5-11-1-3-14-16(7-11)23-9-21-14)6-12-2-4-15-17(8-12)24-10-22-15/h1-5,7-8H,6,9-10H2/b13-5- |
| InChIKey | KXZILZHHXSZSJP-ACAGNQJTSA-N |
| XLogP | 3.00 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(Z)-3-(1,3-benzodioxol-5-yl)-2-nitroprop-2-enyl]-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-3-(1,3-benzodioxol-5-yl)-2-nitroprop-2-enyl]-1,3-benzodioxole?
The IUPAC name of 5-[(Z)-3-(1,3-benzodioxol-5-yl)-2-nitroprop-2-enyl]-1,3-benzodioxole (CID 14938090) is 5-[(Z)-3-(1,3-benzodioxol-5-yl)-2-nitroprop-2-enyl]-1,3-benzodioxole.
What is the SMILES notation for 5-[(Z)-3-(1,3-benzodioxol-5-yl)-2-nitroprop-2-enyl]-1,3-benzodioxole?
The canonical SMILES for 5-[(Z)-3-(1,3-benzodioxol-5-yl)-2-nitroprop-2-enyl]-1,3-benzodioxole is O=[N+]([O-])/C(=C\c1ccc2c(c1)OCO2)Cc1ccc2c(c1)OCO2.
What is the InChIKey of 5-[(Z)-3-(1,3-benzodioxol-5-yl)-2-nitroprop-2-enyl]-1,3-benzodioxole?
The InChIKey is KXZILZHHXSZSJP-ACAGNQJTSA-N. The full InChI is InChI=1S/C17H13NO6/c19-18(20)13(5-11-1-3-14-16(7-11)23-9-21-14)6-12-2-4-15-17(8-12)24-10-22-15/h1-5,7-8H,6,9-10H2/b13-5-.
What are the key properties of 5-[(Z)-3-(1,3-benzodioxol-5-yl)-2-nitroprop-2-enyl]-1,3-benzodioxole?
5-[(Z)-3-(1,3-benzodioxol-5-yl)-2-nitroprop-2-enyl]-1,3-benzodioxole has a molecular weight of 327.29 g/mol, XLogP of 3.00, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-3-(1,3-benzodioxol-5-yl)-2-nitroprop-2-enyl]-1,3-benzodioxole is sourced from PubChem (CID 14938090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).