C44H38N2O8 — CID 14938121
5,11,17,23-tetramethyl-2,14-bis(4-nitrophenyl)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9(27),10,12,15,17,19(26),21(25),22-dodecaene-25,26,27,28-tetrol (PubChem CID 14938121) has the molecular formula C44H38N2O8 and a molecular weight of 722.79 g/mol. Its IUPAC name is 5,11,17,23-tetramethyl-2,14-bis(4-nitrophenyl)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9(27),10,12,15,17,19(26),21(25),22-dodecaene-25,26,27,28-tetrol.
| Compound Name | 5,11,17,23-tetramethyl-2,14-bis(4-nitrophenyl)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9(27),10,12,15,17,19(26),21(25),22-dodecaene-25,26,27,28-tetrol |
|---|---|
| PubChem CID | 14938121 |
| Molecular Formula | C44H38N2O8 |
| Molecular Weight | 722.79 g/mol |
| Exact Mass | 722.26 |
| IUPAC Name | 5,11,17,23-tetramethyl-2,14-bis(4-nitrophenyl)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9(27),10,12,15,17,19(26),21(25),22-dodecaene-25,26,27,28-tetrol |
| SMILES | Cc1cc2c(O)c(c1)C(c1ccc([N+](=O)[O-])cc1)c1cc(C)cc(c1O)Cc1cc(C)cc(c1O)C(c1ccc([N+](=O)[O-])cc1)c1cc(C)cc(c1O)C2 |
| InChI | InChI=1S/C44H38N2O8/c1-23-13-29-21-30-14-24(2)19-37(42(30)48)40(28-7-11-34(12-8-28)46(53)54)38-20-26(4)16-32(44(38)50)22-31-15-25(3)18-36(43(31)49)39(35(17-23)41(29)47)27-5-9-33(10-6-27)45(51)52/h5-20,39-40,47-50H,21-22H2,1-4H3 |
| InChIKey | TXTGGECFFXTFGZ-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 167.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.79 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|